C24H28N4O7 — CID 75307875
trimethyl 8-methyl-14-(propylcarbamoyl)-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate (PubChem CID 75307875) has the molecular formula C24H28N4O7 and a molecular weight of 484.51 g/mol. Its IUPAC name is trimethyl 8-methyl-14-(propylcarbamoyl)-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate.
| Compound Name | trimethyl 8-methyl-14-(propylcarbamoyl)-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate |
|---|---|
| PubChem CID | 75307875 |
| Molecular Formula | C24H28N4O7 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | trimethyl 8-methyl-14-(propylcarbamoyl)-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate |
| SMILES | CCCNC(=O)N1C2=NC(C(=O)OC)=C(C(=O)OC)C3N(C)c4ccccc4C23CC1C(=O)OC |
| InChI | InChI=1S/C24H28N4O7/c1-6-11-25-23(32)28-15(19(29)33-3)12-24-13-9-7-8-10-14(13)27(2)18(24)16(20(30)34-4)17(21(31)35-5)26-22(24)28/h7-10,15,18H,6,11-12H2,1-5H3,(H,25,32) |
| InChIKey | JCPTXMZTAZZLDQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|