About N-(2,1,3-benzothiadiazol-5-yl)pyrrolidine-1-carbothioamide
N-(2,1,3-benzothiadiazol-5-yl)pyrrolidine-1-carbothioamide (PubChem CID 753172) has the molecular formula C11H12N4S2
and a molecular weight of 264.38 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-5-yl)pyrrolidine-1-carbothioamide.
Molecular Properties
| Compound Name | N-(2,1,3-benzothiadiazol-5-yl)pyrrolidine-1-carbothioamide |
| PubChem CID | 753172 |
| Molecular Formula | C11H12N4S2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-5-yl)pyrrolidine-1-carbothioamide |
| SMILES | S=C(Nc1ccc2nsnc2c1)N1CCCC1 |
| InChI | InChI=1S/C11H12N4S2/c16-11(15-5-1-2-6-15)12-8-3-4-9-10(7-8)14-17-13-9/h3-4,7H,1-2,5-6H2,(H,12,16) |
| InChIKey | ROWKHRWNMQPEIS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2,1,3-benzothiadiazol-5-yl)pyrrolidine-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,1,3-benzothiadiazol-5-yl)pyrrolidine-1-carbothioamide?
The IUPAC name of N-(2,1,3-benzothiadiazol-5-yl)pyrrolidine-1-carbothioamide (CID 753172) is N-(2,1,3-benzothiadiazol-5-yl)pyrrolidine-1-carbothioamide.
What is the SMILES notation for N-(2,1,3-benzothiadiazol-5-yl)pyrrolidine-1-carbothioamide?
The canonical SMILES for N-(2,1,3-benzothiadiazol-5-yl)pyrrolidine-1-carbothioamide is S=C(Nc1ccc2nsnc2c1)N1CCCC1.
What is the InChIKey of N-(2,1,3-benzothiadiazol-5-yl)pyrrolidine-1-carbothioamide?
The InChIKey is ROWKHRWNMQPEIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4S2/c16-11(15-5-1-2-6-15)12-8-3-4-9-10(7-8)14-17-13-9/h3-4,7H,1-2,5-6H2,(H,12,16).
What are the key properties of N-(2,1,3-benzothiadiazol-5-yl)pyrrolidine-1-carbothioamide?
N-(2,1,3-benzothiadiazol-5-yl)pyrrolidine-1-carbothioamide has a molecular weight of 264.38 g/mol, XLogP of 2.48, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,1,3-benzothiadiazol-5-yl)pyrrolidine-1-carbothioamide is sourced from PubChem (CID 753172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).