C23H23N5O2 — CID 7532442
4-butoxy-N-[3-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzamide (PubChem CID 7532442) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-butoxy-N-[3-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzamide.
| Compound Name | 4-butoxy-N-[3-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 7532442 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 4-butoxy-N-[3-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2cccc(-c3ccc4nnc(C)n4n3)c2)cc1 |
| InChI | InChI=1S/C23H23N5O2/c1-3-4-14-30-20-10-8-17(9-11-20)23(29)24-19-7-5-6-18(15-19)21-12-13-22-26-25-16(2)28(22)27-21/h5-13,15H,3-4,14H2,1-2H3,(H,24,29) |
| InChIKey | BTJGFXGFLDKWFO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|