C20H18N4O — CID 7532859
5-benzyl-1-(2,3-dimethylphenyl)pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 7532859) has the molecular formula C20H18N4O and a molecular weight of 330.39 g/mol. Its IUPAC name is 5-benzyl-1-(2,3-dimethylphenyl)pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 5-benzyl-1-(2,3-dimethylphenyl)pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7532859 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 5-benzyl-1-(2,3-dimethylphenyl)pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | Cc1cccc(-n2ncc3c(=O)n(Cc4ccccc4)cnc32)c1C |
| InChI | InChI=1S/C20H18N4O/c1-14-7-6-10-18(15(14)2)24-19-17(11-22-24)20(25)23(13-21-19)12-16-8-4-3-5-9-16/h3-11,13H,12H2,1-2H3 |
| InChIKey | DRZZFFZBDBNIJH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |