About 5-oxo-7-phenyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile
5-oxo-7-phenyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile (PubChem CID 753452) has the molecular formula C13H9N3OS
and a molecular weight of 255.30 g/mol. Its IUPAC name is 5-oxo-7-phenyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile.
Molecular Properties
| Compound Name | 5-oxo-7-phenyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile |
| PubChem CID | 753452 |
| Molecular Formula | C13H9N3OS |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 5-oxo-7-phenyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc2n(c1=O)CCS2 |
| InChI | InChI=1S/C13H9N3OS/c14-8-10-11(9-4-2-1-3-5-9)15-13-16(12(10)17)6-7-18-13/h1-5H,6-7H2 |
| InChIKey | BBELKAYISRLZDD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|
Analyze 5-oxo-7-phenyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-7-phenyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile?
The IUPAC name of 5-oxo-7-phenyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile (CID 753452) is 5-oxo-7-phenyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile.
What is the SMILES notation for 5-oxo-7-phenyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile?
The canonical SMILES for 5-oxo-7-phenyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile is N#Cc1c(-c2ccccc2)nc2n(c1=O)CCS2.
What is the InChIKey of 5-oxo-7-phenyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile?
The InChIKey is BBELKAYISRLZDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3OS/c14-8-10-11(9-4-2-1-3-5-9)15-13-16(12(10)17)6-7-18-13/h1-5H,6-7H2.
What are the key properties of 5-oxo-7-phenyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile?
5-oxo-7-phenyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile has a molecular weight of 255.30 g/mol, XLogP of 1.89, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-7-phenyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile is sourced from PubChem (CID 753452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).