About 1-[2-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetyl]imidazolidin-2-one
1-[2-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetyl]imidazolidin-2-one (PubChem CID 7534722) has the molecular formula C14H16N6O2S
and a molecular weight of 332.39 g/mol. Its IUPAC name is 1-[2-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetyl]imidazolidin-2-one.
Molecular Properties
| Compound Name | 1-[2-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetyl]imidazolidin-2-one |
| PubChem CID | 7534722 |
| Molecular Formula | C14H16N6O2S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 1-[2-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetyl]imidazolidin-2-one |
| SMILES | Cc1ccc(-n2nnnc2SCC(=O)N2CCNC2=O)cc1C |
| InChI | InChI=1S/C14H16N6O2S/c1-9-3-4-11(7-10(9)2)20-14(16-17-18-20)23-8-12(21)19-6-5-15-13(19)22/h3-4,7H,5-6,8H2,1-2H3,(H,15,22) |
| InChIKey | LHKCORLBPMAPDM-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[2-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetyl]imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetyl]imidazolidin-2-one?
The IUPAC name of 1-[2-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetyl]imidazolidin-2-one (CID 7534722) is 1-[2-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetyl]imidazolidin-2-one.
What is the SMILES notation for 1-[2-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetyl]imidazolidin-2-one?
The canonical SMILES for 1-[2-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetyl]imidazolidin-2-one is Cc1ccc(-n2nnnc2SCC(=O)N2CCNC2=O)cc1C.
What is the InChIKey of 1-[2-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetyl]imidazolidin-2-one?
The InChIKey is LHKCORLBPMAPDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N6O2S/c1-9-3-4-11(7-10(9)2)20-14(16-17-18-20)23-8-12(21)19-6-5-15-13(19)22/h3-4,7H,5-6,8H2,1-2H3,(H,15,22).
What are the key properties of 1-[2-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetyl]imidazolidin-2-one?
1-[2-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetyl]imidazolidin-2-one has a molecular weight of 332.39 g/mol, XLogP of 0.92, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[1-(3,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetyl]imidazolidin-2-one is sourced from PubChem (CID 7534722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).