C17H16ClN5 — CID 753501
(5R,7R)-5-(4-chlorophenyl)-7-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 753501) has the molecular formula C17H16ClN5 and a molecular weight of 325.80 g/mol. Its IUPAC name is (5R,7R)-5-(4-chlorophenyl)-7-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | (5R,7R)-5-(4-chlorophenyl)-7-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 753501 |
| Molecular Formula | C17H16ClN5 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | (5R,7R)-5-(4-chlorophenyl)-7-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| SMILES | Nc1nc2n(n1)[C@@H](c1ccccc1)C[C@H](c1ccc(Cl)cc1)N2 |
| InChI | InChI=1S/C17H16ClN5/c18-13-8-6-11(7-9-13)14-10-15(12-4-2-1-3-5-12)23-17(20-14)21-16(19)22-23/h1-9,14-15H,10H2,(H3,19,20,21,22)/t14-,15-/m1/s1 |
| InChIKey | JYCMJBUICIJYFQ-HUUCEWRRSA-N |
| XLogP | 3.66 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |