C14H14N2O4 — CID 7535108
N'-(2-hydroxybenzoyl)-2,5-dimethylfuran-3-carbohydrazide (PubChem CID 7535108) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is N'-(2-hydroxybenzoyl)-2,5-dimethylfuran-3-carbohydrazide.
| Compound Name | N'-(2-hydroxybenzoyl)-2,5-dimethylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 7535108 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | N'-(2-hydroxybenzoyl)-2,5-dimethylfuran-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2ccccc2O)c(C)o1 |
| InChI | InChI=1S/C14H14N2O4/c1-8-7-11(9(2)20-8)14(19)16-15-13(18)10-5-3-4-6-12(10)17/h3-7,17H,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | JHXAARXEOQRXMA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|