C20H19N3O5 — CID 7535133
N'-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-2-hydroxybenzohydrazide (PubChem CID 7535133) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is N'-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-2-hydroxybenzohydrazide.
| Compound Name | N'-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 7535133 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | N'-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoyl]-2-hydroxybenzohydrazide |
| SMILES | Cc1noc(C)c1COc1ccc(C(=O)NNC(=O)c2ccccc2O)cc1 |
| InChI | InChI=1S/C20H19N3O5/c1-12-17(13(2)28-23-12)11-27-15-9-7-14(8-10-15)19(25)21-22-20(26)16-5-3-4-6-18(16)24/h3-10,24H,11H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | WUWMDQIBACUYHQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|