C12H18N6S — CID 753519
2-[(4,6-dimethylpyrimidin-2-yl)amino]-N-ethyl-4,5-dihydroimidazole-1-carbothioamide (PubChem CID 753519) has the molecular formula C12H18N6S and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-[(4,6-dimethylpyrimidin-2-yl)amino]-N-ethyl-4,5-dihydroimidazole-1-carbothioamide.
| Compound Name | 2-[(4,6-dimethylpyrimidin-2-yl)amino]-N-ethyl-4,5-dihydroimidazole-1-carbothioamide |
|---|---|
| PubChem CID | 753519 |
| Molecular Formula | C12H18N6S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-[(4,6-dimethylpyrimidin-2-yl)amino]-N-ethyl-4,5-dihydroimidazole-1-carbothioamide |
| SMILES | CCNC(=S)N1CCN=C1Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C12H18N6S/c1-4-13-12(19)18-6-5-14-11(18)17-10-15-8(2)7-9(3)16-10/h7H,4-6H2,1-3H3,(H,13,19)(H,14,15,16,17) |
| InChIKey | VVHRMXZVHHJCDC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|