C15H20F3N6O3+ — CID 75355061
1,3-dimethyl-7-[2-oxo-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]-5H-purin-7-ium-2,6-dione (PubChem CID 75355061) has the molecular formula C15H20F3N6O3+ and a molecular weight of 389.36 g/mol. Its IUPAC name is 1,3-dimethyl-7-[2-oxo-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]-5H-purin-7-ium-2,6-dione.
| Compound Name | 1,3-dimethyl-7-[2-oxo-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 75355061 |
| Molecular Formula | C15H20F3N6O3+ |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 1,3-dimethyl-7-[2-oxo-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC=[N+]2CC(=O)N2CCN(CC(F)(F)F)CC2)N(C)C1=O |
| InChI | InChI=1S/C15H20F3N6O3/c1-20-12-11(13(26)21(2)14(20)27)24(9-19-12)7-10(25)23-5-3-22(4-6-23)8-15(16,17)18/h9,11H,3-8H2,1-2H3/q+1 |
| InChIKey | XFTOPKYPZXLFQS-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|