C20H26N4O3 — CID 75355127
3-[2-(4-cyclohexylpiperazin-1-yl)-2-oxoethyl]-4aH-quinazoline-2,4-dione (PubChem CID 75355127) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 3-[2-(4-cyclohexylpiperazin-1-yl)-2-oxoethyl]-4aH-quinazoline-2,4-dione.
| Compound Name | 3-[2-(4-cyclohexylpiperazin-1-yl)-2-oxoethyl]-4aH-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 75355127 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 3-[2-(4-cyclohexylpiperazin-1-yl)-2-oxoethyl]-4aH-quinazoline-2,4-dione |
| SMILES | O=C(CN1C(=O)N=C2C=CC=CC2C1=O)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C20H26N4O3/c25-18(23-12-10-22(11-13-23)15-6-2-1-3-7-15)14-24-19(26)16-8-4-5-9-17(16)21-20(24)27/h4-5,8-9,15-16H,1-3,6-7,10-14H2 |
| InChIKey | ABLWDDLAGCKSPP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 73.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |