About 7-bromo-4-methyl-1,3-dihydroquinoxalin-2-one
7-bromo-4-methyl-1,3-dihydroquinoxalin-2-one (PubChem CID 75355543) has the molecular formula C9H9BrN2O
and a molecular weight of 241.09 g/mol. Its IUPAC name is 7-bromo-4-methyl-1,3-dihydroquinoxalin-2-one.
Molecular Properties
| Compound Name | 7-bromo-4-methyl-1,3-dihydroquinoxalin-2-one |
| PubChem CID | 75355543 |
| Molecular Formula | C9H9BrN2O |
| Molecular Weight | 241.09 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | 7-bromo-4-methyl-1,3-dihydroquinoxalin-2-one |
| SMILES | CN1CC(=O)Nc2cc(Br)ccc21 |
| InChI | InChI=1S/C9H9BrN2O/c1-12-5-9(13)11-7-4-6(10)2-3-8(7)12/h2-4H,5H2,1H3,(H,11,13) |
| InChIKey | XVTZCPRZOULUOC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.09 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-4-methyl-1,3-dihydroquinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-4-methyl-1,3-dihydroquinoxalin-2-one?
The IUPAC name of 7-bromo-4-methyl-1,3-dihydroquinoxalin-2-one (CID 75355543) is 7-bromo-4-methyl-1,3-dihydroquinoxalin-2-one.
What is the SMILES notation for 7-bromo-4-methyl-1,3-dihydroquinoxalin-2-one?
The canonical SMILES for 7-bromo-4-methyl-1,3-dihydroquinoxalin-2-one is CN1CC(=O)Nc2cc(Br)ccc21.
What is the InChIKey of 7-bromo-4-methyl-1,3-dihydroquinoxalin-2-one?
The InChIKey is XVTZCPRZOULUOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN2O/c1-12-5-9(13)11-7-4-6(10)2-3-8(7)12/h2-4H,5H2,1H3,(H,11,13).
What are the key properties of 7-bromo-4-methyl-1,3-dihydroquinoxalin-2-one?
7-bromo-4-methyl-1,3-dihydroquinoxalin-2-one has a molecular weight of 241.09 g/mol, XLogP of 1.84, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-4-methyl-1,3-dihydroquinoxalin-2-one is sourced from PubChem (CID 75355543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).