About 1-(3,5-dimethyl-4-pyridinyl)piperazine
1-(3,5-dimethyl-4-pyridinyl)piperazine (PubChem CID 75355584) has the molecular formula C11H17N3
and a molecular weight of 191.28 g/mol. Its IUPAC name is 1-(3,5-dimethyl-4-pyridinyl)piperazine.
Molecular Properties
| Compound Name | 1-(3,5-dimethyl-4-pyridinyl)piperazine |
| PubChem CID | 75355584 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 1-(3,5-dimethyl-4-pyridinyl)piperazine |
| SMILES | Cc1cncc(C)c1N1CCNCC1 |
| InChI | InChI=1S/C11H17N3/c1-9-7-13-8-10(2)11(9)14-5-3-12-4-6-14/h7-8,12H,3-6H2,1-2H3 |
| InChIKey | FQSHCYOLEIVSHX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,5-dimethyl-4-pyridinyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dimethyl-4-pyridinyl)piperazine?
The IUPAC name of 1-(3,5-dimethyl-4-pyridinyl)piperazine (CID 75355584) is 1-(3,5-dimethyl-4-pyridinyl)piperazine.
What is the SMILES notation for 1-(3,5-dimethyl-4-pyridinyl)piperazine?
The canonical SMILES for 1-(3,5-dimethyl-4-pyridinyl)piperazine is Cc1cncc(C)c1N1CCNCC1.
What is the InChIKey of 1-(3,5-dimethyl-4-pyridinyl)piperazine?
The InChIKey is FQSHCYOLEIVSHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3/c1-9-7-13-8-10(2)11(9)14-5-3-12-4-6-14/h7-8,12H,3-6H2,1-2H3.
What are the key properties of 1-(3,5-dimethyl-4-pyridinyl)piperazine?
1-(3,5-dimethyl-4-pyridinyl)piperazine has a molecular weight of 191.28 g/mol, XLogP of 1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethyl-4-pyridinyl)piperazine is sourced from PubChem (CID 75355584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).