About 2-amino-2-(1,5-dimethylpyrazol-4-yl)acetic acid
2-amino-2-(1,5-dimethylpyrazol-4-yl)acetic acid (PubChem CID 75355602) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-amino-2-(1,5-dimethylpyrazol-4-yl)acetic acid.
Molecular Properties
| Compound Name | 2-amino-2-(1,5-dimethylpyrazol-4-yl)acetic acid |
| PubChem CID | 75355602 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 2-amino-2-(1,5-dimethylpyrazol-4-yl)acetic acid |
| SMILES | Cc1c(C(N)C(=O)O)cnn1C |
| InChI | InChI=1S/C7H11N3O2/c1-4-5(3-9-10(4)2)6(8)7(11)12/h3,6H,8H2,1-2H3,(H,11,12) |
| InChIKey | IXBXTYHVOPUUSF-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-2-(1,5-dimethylpyrazol-4-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(1,5-dimethylpyrazol-4-yl)acetic acid?
The IUPAC name of 2-amino-2-(1,5-dimethylpyrazol-4-yl)acetic acid (CID 75355602) is 2-amino-2-(1,5-dimethylpyrazol-4-yl)acetic acid.
What is the SMILES notation for 2-amino-2-(1,5-dimethylpyrazol-4-yl)acetic acid?
The canonical SMILES for 2-amino-2-(1,5-dimethylpyrazol-4-yl)acetic acid is Cc1c(C(N)C(=O)O)cnn1C.
What is the InChIKey of 2-amino-2-(1,5-dimethylpyrazol-4-yl)acetic acid?
The InChIKey is IXBXTYHVOPUUSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2/c1-4-5(3-9-10(4)2)6(8)7(11)12/h3,6H,8H2,1-2H3,(H,11,12).
What are the key properties of 2-amino-2-(1,5-dimethylpyrazol-4-yl)acetic acid?
2-amino-2-(1,5-dimethylpyrazol-4-yl)acetic acid has a molecular weight of 169.18 g/mol, XLogP of -0.19, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(1,5-dimethylpyrazol-4-yl)acetic acid is sourced from PubChem (CID 75355602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).