C5H7F2N3O2S — CID 75355935
1-(2,2-difluoroethyl)pyrazole-4-sulfonamide (PubChem CID 75355935) has the molecular formula C5H7F2N3O2S and a molecular weight of 211.19 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)pyrazole-4-sulfonamide.
| Compound Name | 1-(2,2-difluoroethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 75355935 |
| Molecular Formula | C5H7F2N3O2S |
| Molecular Weight | 211.19 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | 1-(2,2-difluoroethyl)pyrazole-4-sulfonamide |
| SMILES | NS(=O)(=O)c1cnn(CC(F)F)c1 |
| InChI | InChI=1S/C5H7F2N3O2S/c6-5(7)3-10-2-4(1-9-10)13(8,11)12/h1-2,5H,3H2,(H2,8,11,12) |
| InChIKey | HYLXROZSDAZMRZ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.19 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |