C8H5NO4 — CID 75356057
5-(furan-3-yl)-1,2-oxazole-4-carboxylic acid (PubChem CID 75356057) has the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. Its IUPAC name is 5-(furan-3-yl)-1,2-oxazole-4-carboxylic acid.
| Compound Name | 5-(furan-3-yl)-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 75356057 |
| Molecular Formula | C8H5NO4 |
| Molecular Weight | 179.13 g/mol |
| Exact Mass | 179.02 |
| IUPAC Name | 5-(furan-3-yl)-1,2-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnoc1-c1ccoc1 |
| InChI | InChI=1S/C8H5NO4/c10-8(11)6-3-9-13-7(6)5-1-2-12-4-5/h1-4H,(H,10,11) |
| InChIKey | NBLAWCJCDVSVRQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.13 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |