C19H21F2N3O2S — CID 75356647
4-(3,4-difluorophenyl)-1-(2,2-dimethyloxan-4-yl)-6-methyl-2,4-dihydropyrazolo[3,4-d][1,3]thiazin-3-one (PubChem CID 75356647) has the molecular formula C19H21F2N3O2S and a molecular weight of 393.46 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-1-(2,2-dimethyloxan-4-yl)-6-methyl-2,4-dihydropyrazolo[3,4-d][1,3]thiazin-3-one.
| Compound Name | 4-(3,4-difluorophenyl)-1-(2,2-dimethyloxan-4-yl)-6-methyl-2,4-dihydropyrazolo[3,4-d][1,3]thiazin-3-one |
|---|---|
| PubChem CID | 75356647 |
| Molecular Formula | C19H21F2N3O2S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 4-(3,4-difluorophenyl)-1-(2,2-dimethyloxan-4-yl)-6-methyl-2,4-dihydropyrazolo[3,4-d][1,3]thiazin-3-one |
| SMILES | CC1=Nc2c(c(=O)[nH]n2C2CCOC(C)(C)C2)C(c2ccc(F)c(F)c2)S1 |
| InChI | InChI=1S/C19H21F2N3O2S/c1-10-22-17-15(16(27-10)11-4-5-13(20)14(21)8-11)18(25)23-24(17)12-6-7-26-19(2,3)9-12/h4-5,8,12,16H,6-7,9H2,1-3H3,(H,23,25) |
| InChIKey | AAALQLSEUCKZOJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |