About 3-(4-fluoro-3-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid
3-(4-fluoro-3-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid (PubChem CID 75360745) has the molecular formula C12H12FNO4
and a molecular weight of 253.23 g/mol. Its IUPAC name is 3-(4-fluoro-3-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-(4-fluoro-3-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid |
| PubChem CID | 75360745 |
| Molecular Formula | C12H12FNO4 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 3-(4-fluoro-3-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid |
| SMILES | COc1cc(C2=NOC(C)(C(=O)O)C2)ccc1F |
| InChI | InChI=1S/C12H12FNO4/c1-12(11(15)16)6-9(14-18-12)7-3-4-8(13)10(5-7)17-2/h3-5H,6H2,1-2H3,(H,15,16) |
| InChIKey | AAQNKNMAFSDHEM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-fluoro-3-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluoro-3-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-(4-fluoro-3-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid (CID 75360745) is 3-(4-fluoro-3-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-(4-fluoro-3-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-(4-fluoro-3-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid is COc1cc(C2=NOC(C)(C(=O)O)C2)ccc1F.
What is the InChIKey of 3-(4-fluoro-3-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid?
The InChIKey is AAQNKNMAFSDHEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FNO4/c1-12(11(15)16)6-9(14-18-12)7-3-4-8(13)10(5-7)17-2/h3-5H,6H2,1-2H3,(H,15,16).
What are the key properties of 3-(4-fluoro-3-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid?
3-(4-fluoro-3-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid has a molecular weight of 253.23 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluoro-3-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 75360745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).