About 2-(tetrazol-1-yl)benzoic acid
2-(tetrazol-1-yl)benzoic acid (PubChem CID 753608) has the molecular formula C8H6N4O2
and a molecular weight of 190.16 g/mol. Its IUPAC name is 2-(tetrazol-1-yl)benzoic acid.
Molecular Properties
| Compound Name | 2-(tetrazol-1-yl)benzoic acid |
| PubChem CID | 753608 |
| Molecular Formula | C8H6N4O2 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 2-(tetrazol-1-yl)benzoic acid |
| SMILES | O=C(O)c1ccccc1-n1cnnn1 |
| InChI | InChI=1S/C8H6N4O2/c13-8(14)6-3-1-2-4-7(6)12-5-9-10-11-12/h1-5H,(H,13,14) |
| InChIKey | BHBFPWBHORPKDU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(tetrazol-1-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tetrazol-1-yl)benzoic acid?
The IUPAC name of 2-(tetrazol-1-yl)benzoic acid (CID 753608) is 2-(tetrazol-1-yl)benzoic acid.
What is the SMILES notation for 2-(tetrazol-1-yl)benzoic acid?
The canonical SMILES for 2-(tetrazol-1-yl)benzoic acid is O=C(O)c1ccccc1-n1cnnn1.
What is the InChIKey of 2-(tetrazol-1-yl)benzoic acid?
The InChIKey is BHBFPWBHORPKDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4O2/c13-8(14)6-3-1-2-4-7(6)12-5-9-10-11-12/h1-5H,(H,13,14).
What are the key properties of 2-(tetrazol-1-yl)benzoic acid?
2-(tetrazol-1-yl)benzoic acid has a molecular weight of 190.16 g/mol, XLogP of 0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tetrazol-1-yl)benzoic acid is sourced from PubChem (CID 753608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).