C6H5F9O — CID 75360834
4-(1,1-difluoroethoxy)-1,1,1,2,2,3,3-heptafluorobutane (PubChem CID 75360834) has the molecular formula C6H5F9O and a molecular weight of 264.09 g/mol. Its IUPAC name is 4-(1,1-difluoroethoxy)-1,1,1,2,2,3,3-heptafluorobutane.
| Compound Name | 4-(1,1-difluoroethoxy)-1,1,1,2,2,3,3-heptafluorobutane |
|---|---|
| PubChem CID | 75360834 |
| Molecular Formula | C6H5F9O |
| Molecular Weight | 264.09 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 4-(1,1-difluoroethoxy)-1,1,1,2,2,3,3-heptafluorobutane |
| SMILES | CC(F)(F)OCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H5F9O/c1-3(7,8)16-2-4(9,10)5(11,12)6(13,14)15/h2H2,1H3 |
| InChIKey | ZAUXRLVUBYXUQJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.09 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|