C9H12F8O3 — CID 75360836
1,3-bis(2,2,3,3-tetrafluoropropoxy)propan-2-ol (PubChem CID 75360836) has the molecular formula C9H12F8O3 and a molecular weight of 320.18 g/mol. Its IUPAC name is 1,3-bis(2,2,3,3-tetrafluoropropoxy)propan-2-ol.
| Compound Name | 1,3-bis(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
|---|---|
| PubChem CID | 75360836 |
| Molecular Formula | C9H12F8O3 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 1,3-bis(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
| SMILES | OC(COCC(F)(F)C(F)F)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H12F8O3/c10-6(11)8(14,15)3-19-1-5(18)2-20-4-9(16,17)7(12)13/h5-7,18H,1-4H2 |
| InChIKey | NJAVGVZXWFYLMP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|