C20H21BrFN5S — CID 75363197
(2E)-2-[3-ethyl-4-(4-fluorophenyl)-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile;hydrobromide (PubChem CID 75363197) has the molecular formula C20H21BrFN5S and a molecular weight of 462.39 g/mol. Its IUPAC name is (2E)-2-[3-ethyl-4-(4-fluorophenyl)-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile;hydrobromide.
| Compound Name | (2E)-2-[3-ethyl-4-(4-fluorophenyl)-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile;hydrobromide |
|---|---|
| PubChem CID | 75363197 |
| Molecular Formula | C20H21BrFN5S |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | (2E)-2-[3-ethyl-4-(4-fluorophenyl)-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile;hydrobromide |
| SMILES | Br.CCN1C(c2ccc(F)cc2)=CS/C1=C(\C#N)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C20H20FN5S.BrH/c1-2-25-17(14-7-9-15(21)10-8-14)13-27-20(25)16(12-22)19-24-23-18-6-4-3-5-11-26(18)19;/h7-10,13H,2-6,11H2,1H3;1H/b20-16+; |
| InChIKey | NMXNDKNFEJKAEY-QTNJPTFUSA-N |
| XLogP | 4.98 |
| TPSA | 57.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|