C17H18N2O3 — CID 75363643
N-[cyclopropyl-(4-methoxyphenyl)methyl]-1-oxidopyridin-1-ium-2-carboxamide (PubChem CID 75363643) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is N-[cyclopropyl-(4-methoxyphenyl)methyl]-1-oxidopyridin-1-ium-2-carboxamide.
| Compound Name | N-[cyclopropyl-(4-methoxyphenyl)methyl]-1-oxidopyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 75363643 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-[cyclopropyl-(4-methoxyphenyl)methyl]-1-oxidopyridin-1-ium-2-carboxamide |
| SMILES | COc1ccc(C(NC(=O)c2cccc[n+]2[O-])C2CC2)cc1 |
| InChI | InChI=1S/C17H18N2O3/c1-22-14-9-7-13(8-10-14)16(12-5-6-12)18-17(20)15-4-2-3-11-19(15)21/h2-4,7-12,16H,5-6H2,1H3,(H,18,20) |
| InChIKey | RPKAUWRITDGGMX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 65.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|