About 5-[(2Z)-2-(2,3-dihydrochromen-4-ylidene)hydrazinyl]-2-methyl-1,3-oxazole-4-carbonitrile
5-[(2Z)-2-(2,3-dihydrochromen-4-ylidene)hydrazinyl]-2-methyl-1,3-oxazole-4-carbonitrile (PubChem CID 75363740) has the molecular formula C14H12N4O2
and a molecular weight of 268.28 g/mol. Its IUPAC name is 5-[(2Z)-2-(2,3-dihydrochromen-4-ylidene)hydrazinyl]-2-methyl-1,3-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-[(2Z)-2-(2,3-dihydrochromen-4-ylidene)hydrazinyl]-2-methyl-1,3-oxazole-4-carbonitrile |
| PubChem CID | 75363740 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 5-[(2Z)-2-(2,3-dihydrochromen-4-ylidene)hydrazinyl]-2-methyl-1,3-oxazole-4-carbonitrile |
| SMILES | Cc1nc(C#N)c(N/N=C2/CCOc3ccccc32)o1 |
| InChI | InChI=1S/C14H12N4O2/c1-9-16-12(8-15)14(20-9)18-17-11-6-7-19-13-5-3-2-4-10(11)13/h2-5,18H,6-7H2,1H3/b17-11- |
| InChIKey | RPTKALYBONAYGB-BOPFTXTBSA-N |
| XLogP | 2.45 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2Z)-2-(2,3-dihydrochromen-4-ylidene)hydrazinyl]-2-methyl-1,3-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2Z)-2-(2,3-dihydrochromen-4-ylidene)hydrazinyl]-2-methyl-1,3-oxazole-4-carbonitrile?
The IUPAC name of 5-[(2Z)-2-(2,3-dihydrochromen-4-ylidene)hydrazinyl]-2-methyl-1,3-oxazole-4-carbonitrile (CID 75363740) is 5-[(2Z)-2-(2,3-dihydrochromen-4-ylidene)hydrazinyl]-2-methyl-1,3-oxazole-4-carbonitrile.
What is the SMILES notation for 5-[(2Z)-2-(2,3-dihydrochromen-4-ylidene)hydrazinyl]-2-methyl-1,3-oxazole-4-carbonitrile?
The canonical SMILES for 5-[(2Z)-2-(2,3-dihydrochromen-4-ylidene)hydrazinyl]-2-methyl-1,3-oxazole-4-carbonitrile is Cc1nc(C#N)c(N/N=C2/CCOc3ccccc32)o1.
What is the InChIKey of 5-[(2Z)-2-(2,3-dihydrochromen-4-ylidene)hydrazinyl]-2-methyl-1,3-oxazole-4-carbonitrile?
The InChIKey is RPTKALYBONAYGB-BOPFTXTBSA-N. The full InChI is InChI=1S/C14H12N4O2/c1-9-16-12(8-15)14(20-9)18-17-11-6-7-19-13-5-3-2-4-10(11)13/h2-5,18H,6-7H2,1H3/b17-11-.
What are the key properties of 5-[(2Z)-2-(2,3-dihydrochromen-4-ylidene)hydrazinyl]-2-methyl-1,3-oxazole-4-carbonitrile?
5-[(2Z)-2-(2,3-dihydrochromen-4-ylidene)hydrazinyl]-2-methyl-1,3-oxazole-4-carbonitrile has a molecular weight of 268.28 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2Z)-2-(2,3-dihydrochromen-4-ylidene)hydrazinyl]-2-methyl-1,3-oxazole-4-carbonitrile is sourced from PubChem (CID 75363740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).