C20H23N5O3S — CID 7536388
[(3R)-3-cyano-4-imino-2-oxopentyl] 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-4-carboxylate (PubChem CID 7536388) has the molecular formula C20H23N5O3S and a molecular weight of 413.50 g/mol. Its IUPAC name is [(3R)-3-cyano-4-imino-2-oxopentyl] 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-4-carboxylate.
| Compound Name | [(3R)-3-cyano-4-imino-2-oxopentyl] 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 7536388 |
| Molecular Formula | C20H23N5O3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | [(3R)-3-cyano-4-imino-2-oxopentyl] 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-4-carboxylate |
| SMILES | [H]/N=C(\C)[C@H](C#N)C(=O)COC(=O)C1CCN(c2ncnc3sc(C)c(C)c23)CC1 |
| InChI | InChI=1S/C20H23N5O3S/c1-11-13(3)29-19-17(11)18(23-10-24-19)25-6-4-14(5-7-25)20(27)28-9-16(26)15(8-21)12(2)22/h10,14-15,22H,4-7,9H2,1-3H3/b22-12+/t15-/m0/s1 |
| InChIKey | ZYGHFKRDGLADGC-OOXYOOLHSA-N |
| XLogP | 2.82 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|