About (2E)-2-(3,3-dimethyl-2-oxobutylidene)-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]-1,3-thiazolidin-4-one
(2E)-2-(3,3-dimethyl-2-oxobutylidene)-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]-1,3-thiazolidin-4-one (PubChem CID 75364613) has the molecular formula C15H25NO3S
and a molecular weight of 299.44 g/mol. Its IUPAC name is (2E)-2-(3,3-dimethyl-2-oxobutylidene)-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | (2E)-2-(3,3-dimethyl-2-oxobutylidene)-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]-1,3-thiazolidin-4-one |
| PubChem CID | 75364613 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | (2E)-2-(3,3-dimethyl-2-oxobutylidene)-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)OCCN1C(=O)CS/C1=C/C(=O)C(C)(C)C |
| InChI | InChI=1S/C15H25NO3S/c1-14(2,3)11(17)9-13-16(12(18)10-20-13)7-8-19-15(4,5)6/h9H,7-8,10H2,1-6H3/b13-9+ |
| InChIKey | JIQVGNSSFOXNFY-UKTHLTGXSA-N |
| XLogP | 2.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(3,3-dimethyl-2-oxobutylidene)-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(3,3-dimethyl-2-oxobutylidene)-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]-1,3-thiazolidin-4-one?
The IUPAC name of (2E)-2-(3,3-dimethyl-2-oxobutylidene)-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]-1,3-thiazolidin-4-one (CID 75364613) is (2E)-2-(3,3-dimethyl-2-oxobutylidene)-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]-1,3-thiazolidin-4-one.
What is the SMILES notation for (2E)-2-(3,3-dimethyl-2-oxobutylidene)-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]-1,3-thiazolidin-4-one?
The canonical SMILES for (2E)-2-(3,3-dimethyl-2-oxobutylidene)-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]-1,3-thiazolidin-4-one is CC(C)(C)OCCN1C(=O)CS/C1=C/C(=O)C(C)(C)C.
What is the InChIKey of (2E)-2-(3,3-dimethyl-2-oxobutylidene)-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]-1,3-thiazolidin-4-one?
The InChIKey is JIQVGNSSFOXNFY-UKTHLTGXSA-N. The full InChI is InChI=1S/C15H25NO3S/c1-14(2,3)11(17)9-13-16(12(18)10-20-13)7-8-19-15(4,5)6/h9H,7-8,10H2,1-6H3/b13-9+.
What are the key properties of (2E)-2-(3,3-dimethyl-2-oxobutylidene)-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]-1,3-thiazolidin-4-one?
(2E)-2-(3,3-dimethyl-2-oxobutylidene)-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]-1,3-thiazolidin-4-one has a molecular weight of 299.44 g/mol, XLogP of 2.83, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(3,3-dimethyl-2-oxobutylidene)-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]-1,3-thiazolidin-4-one is sourced from PubChem (CID 75364613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).