About (1S,5R)-3-methyl-1,5-diphenyl-6-azoniabicyclo[3.1.1]heptan-7-one
(1S,5R)-3-methyl-1,5-diphenyl-6-azoniabicyclo[3.1.1]heptan-7-one (PubChem CID 7536504) has the molecular formula C19H20NO+
and a molecular weight of 278.38 g/mol. Its IUPAC name is (1S,5R)-3-methyl-1,5-diphenyl-6-azoniabicyclo[3.1.1]heptan-7-one.
Molecular Properties
| Compound Name | (1S,5R)-3-methyl-1,5-diphenyl-6-azoniabicyclo[3.1.1]heptan-7-one |
| PubChem CID | 7536504 |
| Molecular Formula | C19H20NO+ |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (1S,5R)-3-methyl-1,5-diphenyl-6-azoniabicyclo[3.1.1]heptan-7-one |
| SMILES | CC1C[C@]2(c3ccccc3)[NH2+][C@](c3ccccc3)(C1)C2=O |
| InChI | InChI=1S/C19H19NO/c1-14-12-18(15-8-4-2-5-9-15)17(21)19(13-14,20-18)16-10-6-3-7-11-16/h2-11,14,20H,12-13H2,1H3/p+1/t14?,18-,19+ |
| InChIKey | SRTOSOBTVMFSBG-WUUXGELPSA-O |
| XLogP | 2.35 |
| TPSA | 33.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S,5R)-3-methyl-1,5-diphenyl-6-azoniabicyclo[3.1.1]heptan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-3-methyl-1,5-diphenyl-6-azoniabicyclo[3.1.1]heptan-7-one?
The IUPAC name of (1S,5R)-3-methyl-1,5-diphenyl-6-azoniabicyclo[3.1.1]heptan-7-one (CID 7536504) is (1S,5R)-3-methyl-1,5-diphenyl-6-azoniabicyclo[3.1.1]heptan-7-one.
What is the SMILES notation for (1S,5R)-3-methyl-1,5-diphenyl-6-azoniabicyclo[3.1.1]heptan-7-one?
The canonical SMILES for (1S,5R)-3-methyl-1,5-diphenyl-6-azoniabicyclo[3.1.1]heptan-7-one is CC1C[C@]2(c3ccccc3)[NH2+][C@](c3ccccc3)(C1)C2=O.
What is the InChIKey of (1S,5R)-3-methyl-1,5-diphenyl-6-azoniabicyclo[3.1.1]heptan-7-one?
The InChIKey is SRTOSOBTVMFSBG-WUUXGELPSA-O. The full InChI is InChI=1S/C19H19NO/c1-14-12-18(15-8-4-2-5-9-15)17(21)19(13-14,20-18)16-10-6-3-7-11-16/h2-11,14,20H,12-13H2,1H3/p+1/t14?,18-,19+.
What are the key properties of (1S,5R)-3-methyl-1,5-diphenyl-6-azoniabicyclo[3.1.1]heptan-7-one?
(1S,5R)-3-methyl-1,5-diphenyl-6-azoniabicyclo[3.1.1]heptan-7-one has a molecular weight of 278.38 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-3-methyl-1,5-diphenyl-6-azoniabicyclo[3.1.1]heptan-7-one is sourced from PubChem (CID 7536504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).