About 1-(1-adamantyl)-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea
1-(1-adamantyl)-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea (PubChem CID 75365065) has the molecular formula C20H27N5O
and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea.
Molecular Properties
| Compound Name | 1-(1-adamantyl)-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea |
| PubChem CID | 75365065 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 1-(1-adamantyl)-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea |
| SMILES | CC(C)n1ncc2cc(NC(=O)NC34CC5CC(CC(C5)C3)C4)cnc21 |
| InChI | InChI=1S/C20H27N5O/c1-12(2)25-18-16(10-22-25)6-17(11-21-18)23-19(26)24-20-7-13-3-14(8-20)5-15(4-13)9-20/h6,10-15H,3-5,7-9H2,1-2H3,(H2,23,24,26) |
| InChIKey | FXASLQIJYPXGTF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1-adamantyl)-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-adamantyl)-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea?
The IUPAC name of 1-(1-adamantyl)-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea (CID 75365065) is 1-(1-adamantyl)-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea.
What is the SMILES notation for 1-(1-adamantyl)-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea?
The canonical SMILES for 1-(1-adamantyl)-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea is CC(C)n1ncc2cc(NC(=O)NC34CC5CC(CC(C5)C3)C4)cnc21.
What is the InChIKey of 1-(1-adamantyl)-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea?
The InChIKey is FXASLQIJYPXGTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N5O/c1-12(2)25-18-16(10-22-25)6-17(11-21-18)23-19(26)24-20-7-13-3-14(8-20)5-15(4-13)9-20/h6,10-15H,3-5,7-9H2,1-2H3,(H2,23,24,26).
What are the key properties of 1-(1-adamantyl)-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea?
1-(1-adamantyl)-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea has a molecular weight of 353.47 g/mol, XLogP of 4.10, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-adamantyl)-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea is sourced from PubChem (CID 75365065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).