C8H4BrF5O — CID 75365408
1-bromo-3-(difluoromethoxy)-5-(trifluoromethyl)benzene (PubChem CID 75365408) has the molecular formula C8H4BrF5O and a molecular weight of 291.01 g/mol. Its IUPAC name is 1-bromo-3-(difluoromethoxy)-5-(trifluoromethyl)benzene.
| Compound Name | 1-bromo-3-(difluoromethoxy)-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 75365408 |
| Molecular Formula | C8H4BrF5O |
| Molecular Weight | 291.01 g/mol |
| Exact Mass | 289.94 |
| IUPAC Name | 1-bromo-3-(difluoromethoxy)-5-(trifluoromethyl)benzene |
| SMILES | FC(F)Oc1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H4BrF5O/c9-5-1-4(8(12,13)14)2-6(3-5)15-7(10)11/h1-3,7H |
| InChIKey | BZRTUDRFAMWDKM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.01 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |