C12H18N4 — CID 75365664
N-pyrimidin-2-yl-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine (PubChem CID 75365664) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is N-pyrimidin-2-yl-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine.
| Compound Name | N-pyrimidin-2-yl-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine |
|---|---|
| PubChem CID | 75365664 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | N-pyrimidin-2-yl-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine |
| SMILES | c1cnc(NC2CCN3CCCC3C2)nc1 |
| InChI | InChI=1S/C12H18N4/c1-3-11-9-10(4-8-16(11)7-1)15-12-13-5-2-6-14-12/h2,5-6,10-11H,1,3-4,7-9H2,(H,13,14,15) |
| InChIKey | CEDNNISAJTWLRV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |