C12H16ClNO2 — CID 75366040
3,6,7,8,9,10-hexahydro-2H-[1,4]dioxino[2,3-h][2]benzazepine;hydrochloride (PubChem CID 75366040) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is 3,6,7,8,9,10-hexahydro-2H-[1,4]dioxino[2,3-h][2]benzazepine;hydrochloride.
| Compound Name | 3,6,7,8,9,10-hexahydro-2H-[1,4]dioxino[2,3-h][2]benzazepine;hydrochloride |
|---|---|
| PubChem CID | 75366040 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 3,6,7,8,9,10-hexahydro-2H-[1,4]dioxino[2,3-h][2]benzazepine;hydrochloride |
| SMILES | Cl.c1c2c(cc3c1OCCO3)CNCCC2 |
| InChI | InChI=1S/C12H15NO2.ClH/c1-2-9-6-11-12(15-5-4-14-11)7-10(9)8-13-3-1;/h6-7,13H,1-5,8H2;1H |
| InChIKey | WAZKWBDKDRRBAA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |