About 2-amino-7,8-dimethyl-3-(1-methylbenzimidazol-2-yl)chromeno[2,3-b]pyridin-5-one
2-amino-7,8-dimethyl-3-(1-methylbenzimidazol-2-yl)chromeno[2,3-b]pyridin-5-one (PubChem CID 75366120) has the molecular formula C22H18N4O2
and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-amino-7,8-dimethyl-3-(1-methylbenzimidazol-2-yl)chromeno[2,3-b]pyridin-5-one.
Molecular Properties
| Compound Name | 2-amino-7,8-dimethyl-3-(1-methylbenzimidazol-2-yl)chromeno[2,3-b]pyridin-5-one |
| PubChem CID | 75366120 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-amino-7,8-dimethyl-3-(1-methylbenzimidazol-2-yl)chromeno[2,3-b]pyridin-5-one |
| SMILES | Cc1cc2oc3nc(N)c(-c4nc5ccccc5n4C)cc3c(=O)c2cc1C |
| InChI | InChI=1S/C22H18N4O2/c1-11-8-13-18(9-12(11)2)28-22-14(19(13)27)10-15(20(23)25-22)21-24-16-6-4-5-7-17(16)26(21)3/h4-10H,1-3H3,(H2,23,25) |
| InChIKey | UWENAXASFCIDQI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-7,8-dimethyl-3-(1-methylbenzimidazol-2-yl)chromeno[2,3-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7,8-dimethyl-3-(1-methylbenzimidazol-2-yl)chromeno[2,3-b]pyridin-5-one?
The IUPAC name of 2-amino-7,8-dimethyl-3-(1-methylbenzimidazol-2-yl)chromeno[2,3-b]pyridin-5-one (CID 75366120) is 2-amino-7,8-dimethyl-3-(1-methylbenzimidazol-2-yl)chromeno[2,3-b]pyridin-5-one.
What is the SMILES notation for 2-amino-7,8-dimethyl-3-(1-methylbenzimidazol-2-yl)chromeno[2,3-b]pyridin-5-one?
The canonical SMILES for 2-amino-7,8-dimethyl-3-(1-methylbenzimidazol-2-yl)chromeno[2,3-b]pyridin-5-one is Cc1cc2oc3nc(N)c(-c4nc5ccccc5n4C)cc3c(=O)c2cc1C.
What is the InChIKey of 2-amino-7,8-dimethyl-3-(1-methylbenzimidazol-2-yl)chromeno[2,3-b]pyridin-5-one?
The InChIKey is UWENAXASFCIDQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N4O2/c1-11-8-13-18(9-12(11)2)28-22-14(19(13)27)10-15(20(23)25-22)21-24-16-6-4-5-7-17(16)26(21)3/h4-10H,1-3H3,(H2,23,25).
What are the key properties of 2-amino-7,8-dimethyl-3-(1-methylbenzimidazol-2-yl)chromeno[2,3-b]pyridin-5-one?
2-amino-7,8-dimethyl-3-(1-methylbenzimidazol-2-yl)chromeno[2,3-b]pyridin-5-one has a molecular weight of 370.41 g/mol, XLogP of 4.09, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7,8-dimethyl-3-(1-methylbenzimidazol-2-yl)chromeno[2,3-b]pyridin-5-one is sourced from PubChem (CID 75366120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).