C22H31N3O3 — CID 75366540
cyclooctane;2-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]-N-methylacetamide (PubChem CID 75366540) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is cyclooctane;2-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]-N-methylacetamide.
| Compound Name | cyclooctane;2-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 75366540 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | cyclooctane;2-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]-N-methylacetamide |
| SMILES | C1CCCCCCC1.CNC(=O)Cn1nc(-c2ccc(OC)cc2)ccc1=O |
| InChI | InChI=1S/C14H15N3O3.C8H16/c1-15-13(18)9-17-14(19)8-7-12(16-17)10-3-5-11(20-2)6-4-10;1-2-4-6-8-7-5-3-1/h3-8H,9H2,1-2H3,(H,15,18);1-8H2 |
| InChIKey | NCFPTVYTQWRAAV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |