C13H23NO2 — CID 75366827
(2E)-N-methoxy-N,4,8-trimethylnona-2,7-dienamide (PubChem CID 75366827) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is (2E)-N-methoxy-N,4,8-trimethylnona-2,7-dienamide.
| Compound Name | (2E)-N-methoxy-N,4,8-trimethylnona-2,7-dienamide |
|---|---|
| PubChem CID | 75366827 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (2E)-N-methoxy-N,4,8-trimethylnona-2,7-dienamide |
| SMILES | CON(C)C(=O)/C=C/C(C)CCC=C(C)C |
| InChI | InChI=1S/C13H23NO2/c1-11(2)7-6-8-12(3)9-10-13(15)14(4)16-5/h7,9-10,12H,6,8H2,1-5H3/b10-9+ |
| InChIKey | NDIWFAPLPTUGNF-MDZDMXLPSA-N |
| XLogP | 2.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|