C12H23NO5 — CID 75368022
N-[[(3R,4S)-3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]acetamide (PubChem CID 75368022) has the molecular formula C12H23NO5 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-[[(3R,4S)-3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]acetamide.
| Compound Name | N-[[(3R,4S)-3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]acetamide |
|---|---|
| PubChem CID | 75368022 |
| Molecular Formula | C12H23NO5 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | N-[[(3R,4S)-3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]acetamide |
| SMILES | COCCOCC1(CNC(C)=O)C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C12H23NO5/c1-9(14)13-7-12(8-18-4-3-17-2)5-10(15)11(16)6-12/h10-11,15-16H,3-8H2,1-2H3,(H,13,14)/t10-,11+,12? |
| InChIKey | DSWZPLOBJBUJDG-FOSCPWQOSA-N |
| XLogP | -0.71 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|