C14H25NO5 — CID 75368025
N-[[(3R,4S)-3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide (PubChem CID 75368025) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-[[(3R,4S)-3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide.
| Compound Name | N-[[(3R,4S)-3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 75368025 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-[[(3R,4S)-3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide |
| SMILES | COCCOCC1(CNC(=O)C2CC2)C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C14H25NO5/c1-19-4-5-20-9-14(6-11(16)12(17)7-14)8-15-13(18)10-2-3-10/h10-12,16-17H,2-9H2,1H3,(H,15,18)/t11-,12+,14? |
| InChIKey | HUTOHYICWDGSEO-ONXXMXGDSA-N |
| XLogP | -0.32 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|