C13H25NO6 — CID 75368028
N-[[(3R,4S)-3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]-2-methoxyacetamide (PubChem CID 75368028) has the molecular formula C13H25NO6 and a molecular weight of 291.34 g/mol. Its IUPAC name is N-[[(3R,4S)-3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]-2-methoxyacetamide.
| Compound Name | N-[[(3R,4S)-3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 75368028 |
| Molecular Formula | C13H25NO6 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-[[(3R,4S)-3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]-2-methoxyacetamide |
| SMILES | COCCOCC1(CNC(=O)COC)C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C13H25NO6/c1-18-3-4-20-9-13(5-10(15)11(16)6-13)8-14-12(17)7-19-2/h10-11,15-16H,3-9H2,1-2H3,(H,14,17)/t10-,11+,13? |
| InChIKey | NRBIEGWMWQQEQA-QYJAPNMZSA-N |
| XLogP | -1.09 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|