C16H29NO6 — CID 75368036
N-[[(3R,4S)-3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]oxane-4-carboxamide (PubChem CID 75368036) has the molecular formula C16H29NO6 and a molecular weight of 331.41 g/mol. Its IUPAC name is N-[[(3R,4S)-3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]oxane-4-carboxamide.
| Compound Name | N-[[(3R,4S)-3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 75368036 |
| Molecular Formula | C16H29NO6 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | N-[[(3R,4S)-3,4-dihydroxy-1-(2-methoxyethoxymethyl)cyclopentyl]methyl]oxane-4-carboxamide |
| SMILES | COCCOCC1(CNC(=O)C2CCOCC2)C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C16H29NO6/c1-21-6-7-23-11-16(8-13(18)14(19)9-16)10-17-15(20)12-2-4-22-5-3-12/h12-14,18-19H,2-11H2,1H3,(H,17,20)/t13-,14+,16? |
| InChIKey | RYYWUFWVRRMGTC-MZBDJJRSSA-N |
| XLogP | -0.31 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|