C14H27NO4 — CID 75368118
cis-(1S,2R)-4-[(cyclopropylmethylamino)methyl]-4-(2-methoxyethoxymethyl)cyclopentane-1,2-diol (PubChem CID 75368118) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is cis-(1S,2R)-4-[(cyclopropylmethylamino)methyl]-4-(2-methoxyethoxymethyl)cyclopentane-1,2-diol.
| Compound Name | cis-(1S,2R)-4-[(cyclopropylmethylamino)methyl]-4-(2-methoxyethoxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 75368118 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | cis-(1S,2R)-4-[(cyclopropylmethylamino)methyl]-4-(2-methoxyethoxymethyl)cyclopentane-1,2-diol |
| SMILES | COCCOCC1(CNCC2CC2)C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C14H27NO4/c1-18-4-5-19-10-14(6-12(16)13(17)7-14)9-15-8-11-2-3-11/h11-13,15-17H,2-10H2,1H3/t12-,13+,14? |
| InChIKey | XYHCAKGXENVIBM-PBWFPOADSA-N |
| XLogP | 0.15 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|