About cis-(1S,2R)-4-[(cyclopentylmethylamino)methyl]-4-(2-methoxyethoxymethyl)cyclopentane-1,2-diol
cis-(1S,2R)-4-[(cyclopentylmethylamino)methyl]-4-(2-methoxyethoxymethyl)cyclopentane-1,2-diol (PubChem CID 75368123) has the molecular formula C16H31NO4
and a molecular weight of 301.43 g/mol. Its IUPAC name is cis-(1S,2R)-4-[(cyclopentylmethylamino)methyl]-4-(2-methoxyethoxymethyl)cyclopentane-1,2-diol.
Molecular Properties
| Compound Name | cis-(1S,2R)-4-[(cyclopentylmethylamino)methyl]-4-(2-methoxyethoxymethyl)cyclopentane-1,2-diol |
| PubChem CID | 75368123 |
| Molecular Formula | C16H31NO4 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | cis-(1S,2R)-4-[(cyclopentylmethylamino)methyl]-4-(2-methoxyethoxymethyl)cyclopentane-1,2-diol |
| SMILES | COCCOCC1(CNCC2CCCC2)C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C16H31NO4/c1-20-6-7-21-12-16(8-14(18)15(19)9-16)11-17-10-13-4-2-3-5-13/h13-15,17-19H,2-12H2,1H3/t14-,15+,16? |
| InChIKey | XXHKTMUOEAQNHK-XYPWUTKMSA-N |
| XLogP | 0.93 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cis-(1S,2R)-4-[(cyclopentylmethylamino)methyl]-4-(2-methoxyethoxymethyl)cyclopentane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-4-[(cyclopentylmethylamino)methyl]-4-(2-methoxyethoxymethyl)cyclopentane-1,2-diol?
The IUPAC name of cis-(1S,2R)-4-[(cyclopentylmethylamino)methyl]-4-(2-methoxyethoxymethyl)cyclopentane-1,2-diol (CID 75368123) is cis-(1S,2R)-4-[(cyclopentylmethylamino)methyl]-4-(2-methoxyethoxymethyl)cyclopentane-1,2-diol.
What is the SMILES notation for cis-(1S,2R)-4-[(cyclopentylmethylamino)methyl]-4-(2-methoxyethoxymethyl)cyclopentane-1,2-diol?
The canonical SMILES for cis-(1S,2R)-4-[(cyclopentylmethylamino)methyl]-4-(2-methoxyethoxymethyl)cyclopentane-1,2-diol is COCCOCC1(CNCC2CCCC2)C[C@@H](O)[C@@H](O)C1.
What is the InChIKey of cis-(1S,2R)-4-[(cyclopentylmethylamino)methyl]-4-(2-methoxyethoxymethyl)cyclopentane-1,2-diol?
The InChIKey is XXHKTMUOEAQNHK-XYPWUTKMSA-N. The full InChI is InChI=1S/C16H31NO4/c1-20-6-7-21-12-16(8-14(18)15(19)9-16)11-17-10-13-4-2-3-5-13/h13-15,17-19H,2-12H2,1H3/t14-,15+,16?.
What are the key properties of cis-(1S,2R)-4-[(cyclopentylmethylamino)methyl]-4-(2-methoxyethoxymethyl)cyclopentane-1,2-diol?
cis-(1S,2R)-4-[(cyclopentylmethylamino)methyl]-4-(2-methoxyethoxymethyl)cyclopentane-1,2-diol has a molecular weight of 301.43 g/mol, XLogP of 0.93, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-4-[(cyclopentylmethylamino)methyl]-4-(2-methoxyethoxymethyl)cyclopentane-1,2-diol is sourced from PubChem (CID 75368123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).