C12H22N4O — CID 75368548
(8aS)-7-(1-methylpiperidin-4-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 75368548) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is (8aS)-7-(1-methylpiperidin-4-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | (8aS)-7-(1-methylpiperidin-4-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 75368548 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | (8aS)-7-(1-methylpiperidin-4-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | CN1CCC(N2CCN3C(=O)NC[C@H]3C2)CC1 |
| InChI | InChI=1S/C12H22N4O/c1-14-4-2-10(3-5-14)15-6-7-16-11(9-15)8-13-12(16)17/h10-11H,2-9H2,1H3,(H,13,17)/t11-/m0/s1 |
| InChIKey | ARFGFHZUTOUQPO-NSHDSACASA-N |
| XLogP | -0.21 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |