C13H16O5 — CID 75368714
8-methyl-3,4,6,10b-tetrahydro-2H-pyrano[3,2-c]isochromene-4a,7,9-triol (PubChem CID 75368714) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 8-methyl-3,4,6,10b-tetrahydro-2H-pyrano[3,2-c]isochromene-4a,7,9-triol.
| Compound Name | 8-methyl-3,4,6,10b-tetrahydro-2H-pyrano[3,2-c]isochromene-4a,7,9-triol |
|---|---|
| PubChem CID | 75368714 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 8-methyl-3,4,6,10b-tetrahydro-2H-pyrano[3,2-c]isochromene-4a,7,9-triol |
| SMILES | Cc1c(O)cc2c(c1O)COC1(O)CCCOC21 |
| InChI | InChI=1S/C13H16O5/c1-7-10(14)5-8-9(11(7)15)6-18-13(16)3-2-4-17-12(8)13/h5,12,14-16H,2-4,6H2,1H3 |
| InChIKey | IVGBZDPNMAOBQK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |