C20H30O5 — CID 75368720
(7E,11E)-14-ethyl-13-hydroxy-3,5,7,9,13-pentamethyl-1-oxacyclotetradeca-7,11-diene-2,6,10-trione (PubChem CID 75368720) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (7E,11E)-14-ethyl-13-hydroxy-3,5,7,9,13-pentamethyl-1-oxacyclotetradeca-7,11-diene-2,6,10-trione.
| Compound Name | (7E,11E)-14-ethyl-13-hydroxy-3,5,7,9,13-pentamethyl-1-oxacyclotetradeca-7,11-diene-2,6,10-trione |
|---|---|
| PubChem CID | 75368720 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (7E,11E)-14-ethyl-13-hydroxy-3,5,7,9,13-pentamethyl-1-oxacyclotetradeca-7,11-diene-2,6,10-trione |
| SMILES | CCC1OC(=O)C(C)CC(C)C(=O)/C(C)=C/C(C)C(=O)/C=C/C1(C)O |
| InChI | InChI=1S/C20H30O5/c1-7-17-20(6,24)9-8-16(21)12(2)10-13(3)18(22)14(4)11-15(5)19(23)25-17/h8-10,12,14-15,17,24H,7,11H2,1-6H3/b9-8+,13-10+ |
| InChIKey | BIGBTKXKWUHWLH-PEGOPYGQSA-N |
| XLogP | 3.01 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |