About 2-(5,6-dihydroxy-3-methoxycarbonylcyclohex-3-en-1-yl)oxypropanoic acid
2-(5,6-dihydroxy-3-methoxycarbonylcyclohex-3-en-1-yl)oxypropanoic acid (PubChem CID 75368728) has the molecular formula C11H16O7
and a molecular weight of 260.24 g/mol. Its IUPAC name is 2-(5,6-dihydroxy-3-methoxycarbonylcyclohex-3-en-1-yl)oxypropanoic acid.
Molecular Properties
| Compound Name | 2-(5,6-dihydroxy-3-methoxycarbonylcyclohex-3-en-1-yl)oxypropanoic acid |
| PubChem CID | 75368728 |
| Molecular Formula | C11H16O7 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 2-(5,6-dihydroxy-3-methoxycarbonylcyclohex-3-en-1-yl)oxypropanoic acid |
| SMILES | COC(=O)C1=CC(O)C(O)C(OC(C)C(=O)O)C1 |
| InChI | InChI=1S/C11H16O7/c1-5(10(14)15)18-8-4-6(11(16)17-2)3-7(12)9(8)13/h3,5,7-9,12-13H,4H2,1-2H3,(H,14,15) |
| InChIKey | QEIITRXHOIHGMT-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(5,6-dihydroxy-3-methoxycarbonylcyclohex-3-en-1-yl)oxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,6-dihydroxy-3-methoxycarbonylcyclohex-3-en-1-yl)oxypropanoic acid?
The IUPAC name of 2-(5,6-dihydroxy-3-methoxycarbonylcyclohex-3-en-1-yl)oxypropanoic acid (CID 75368728) is 2-(5,6-dihydroxy-3-methoxycarbonylcyclohex-3-en-1-yl)oxypropanoic acid.
What is the SMILES notation for 2-(5,6-dihydroxy-3-methoxycarbonylcyclohex-3-en-1-yl)oxypropanoic acid?
The canonical SMILES for 2-(5,6-dihydroxy-3-methoxycarbonylcyclohex-3-en-1-yl)oxypropanoic acid is COC(=O)C1=CC(O)C(O)C(OC(C)C(=O)O)C1.
What is the InChIKey of 2-(5,6-dihydroxy-3-methoxycarbonylcyclohex-3-en-1-yl)oxypropanoic acid?
The InChIKey is QEIITRXHOIHGMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O7/c1-5(10(14)15)18-8-4-6(11(16)17-2)3-7(12)9(8)13/h3,5,7-9,12-13H,4H2,1-2H3,(H,14,15).
What are the key properties of 2-(5,6-dihydroxy-3-methoxycarbonylcyclohex-3-en-1-yl)oxypropanoic acid?
2-(5,6-dihydroxy-3-methoxycarbonylcyclohex-3-en-1-yl)oxypropanoic acid has a molecular weight of 260.24 g/mol, XLogP of -0.93, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,6-dihydroxy-3-methoxycarbonylcyclohex-3-en-1-yl)oxypropanoic acid is sourced from PubChem (CID 75368728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).