About 2-phenyl-4-pyrido[2,3-b]pyrazin-6-ylmorpholine
2-phenyl-4-pyrido[2,3-b]pyrazin-6-ylmorpholine (PubChem CID 75368986) has the molecular formula C17H16N4O
and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-phenyl-4-pyrido[2,3-b]pyrazin-6-ylmorpholine.
Molecular Properties
| Compound Name | 2-phenyl-4-pyrido[2,3-b]pyrazin-6-ylmorpholine |
| PubChem CID | 75368986 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-phenyl-4-pyrido[2,3-b]pyrazin-6-ylmorpholine |
| SMILES | c1ccc(C2CN(c3ccc4nccnc4n3)CCO2)cc1 |
| InChI | InChI=1S/C17H16N4O/c1-2-4-13(5-3-1)15-12-21(10-11-22-15)16-7-6-14-17(20-16)19-9-8-18-14/h1-9,15H,10-12H2 |
| InChIKey | VWXBOUACPWTXDZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-phenyl-4-pyrido[2,3-b]pyrazin-6-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-4-pyrido[2,3-b]pyrazin-6-ylmorpholine?
The IUPAC name of 2-phenyl-4-pyrido[2,3-b]pyrazin-6-ylmorpholine (CID 75368986) is 2-phenyl-4-pyrido[2,3-b]pyrazin-6-ylmorpholine.
What is the SMILES notation for 2-phenyl-4-pyrido[2,3-b]pyrazin-6-ylmorpholine?
The canonical SMILES for 2-phenyl-4-pyrido[2,3-b]pyrazin-6-ylmorpholine is c1ccc(C2CN(c3ccc4nccnc4n3)CCO2)cc1.
What is the InChIKey of 2-phenyl-4-pyrido[2,3-b]pyrazin-6-ylmorpholine?
The InChIKey is VWXBOUACPWTXDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O/c1-2-4-13(5-3-1)15-12-21(10-11-22-15)16-7-6-14-17(20-16)19-9-8-18-14/h1-9,15H,10-12H2.
What are the key properties of 2-phenyl-4-pyrido[2,3-b]pyrazin-6-ylmorpholine?
2-phenyl-4-pyrido[2,3-b]pyrazin-6-ylmorpholine has a molecular weight of 292.34 g/mol, XLogP of 2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-4-pyrido[2,3-b]pyrazin-6-ylmorpholine is sourced from PubChem (CID 75368986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).