C25H28N2O2S — CID 7536904
N-butyl-2-[(2-naphthalen-1-ylacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 7536904) has the molecular formula C25H28N2O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is N-butyl-2-[(2-naphthalen-1-ylacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-butyl-2-[(2-naphthalen-1-ylacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 7536904 |
| Molecular Formula | C25H28N2O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | N-butyl-2-[(2-naphthalen-1-ylacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCCCNC(=O)c1c(NC(=O)Cc2cccc3ccccc23)sc2c1CCCC2 |
| InChI | InChI=1S/C25H28N2O2S/c1-2-3-15-26-24(29)23-20-13-6-7-14-21(20)30-25(23)27-22(28)16-18-11-8-10-17-9-4-5-12-19(17)18/h4-5,8-12H,2-3,6-7,13-16H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | OYVRFWZQQBKVFJ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|