About 2-[3-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-N-(2-phenylethyl)acetamide
2-[3-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-N-(2-phenylethyl)acetamide (PubChem CID 75369818) has the molecular formula C18H24N4OS
and a molecular weight of 344.48 g/mol. Its IUPAC name is 2-[3-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-N-(2-phenylethyl)acetamide.
Molecular Properties
| Compound Name | 2-[3-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-N-(2-phenylethyl)acetamide |
| PubChem CID | 75369818 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-[3-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-N-(2-phenylethyl)acetamide |
| SMILES | CC1CN(CC(=O)NCCc2ccccc2)CCN1c1nccs1 |
| InChI | InChI=1S/C18H24N4OS/c1-15-13-21(10-11-22(15)18-20-9-12-24-18)14-17(23)19-8-7-16-5-3-2-4-6-16/h2-6,9,12,15H,7-8,10-11,13-14H2,1H3,(H,19,23) |
| InChIKey | IGMAVSJIGPWTHG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-N-(2-phenylethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-N-(2-phenylethyl)acetamide?
The IUPAC name of 2-[3-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-N-(2-phenylethyl)acetamide (CID 75369818) is 2-[3-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-N-(2-phenylethyl)acetamide.
What is the SMILES notation for 2-[3-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-N-(2-phenylethyl)acetamide?
The canonical SMILES for 2-[3-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-N-(2-phenylethyl)acetamide is CC1CN(CC(=O)NCCc2ccccc2)CCN1c1nccs1.
What is the InChIKey of 2-[3-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-N-(2-phenylethyl)acetamide?
The InChIKey is IGMAVSJIGPWTHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4OS/c1-15-13-21(10-11-22(15)18-20-9-12-24-18)14-17(23)19-8-7-16-5-3-2-4-6-16/h2-6,9,12,15H,7-8,10-11,13-14H2,1H3,(H,19,23).
What are the key properties of 2-[3-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-N-(2-phenylethyl)acetamide?
2-[3-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-N-(2-phenylethyl)acetamide has a molecular weight of 344.48 g/mol, XLogP of 2.01, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-methyl-4-(1,3-thiazol-2-yl)piperazin-1-yl]-N-(2-phenylethyl)acetamide is sourced from PubChem (CID 75369818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).