About 1-[(3,5-difluorophenyl)methyl]-3-[1-(4-methylpiperazin-1-yl)propan-2-yl]urea
1-[(3,5-difluorophenyl)methyl]-3-[1-(4-methylpiperazin-1-yl)propan-2-yl]urea (PubChem CID 75369977) has the molecular formula C16H24F2N4O
and a molecular weight of 326.39 g/mol. Its IUPAC name is 1-[(3,5-difluorophenyl)methyl]-3-[1-(4-methylpiperazin-1-yl)propan-2-yl]urea.
Molecular Properties
| Compound Name | 1-[(3,5-difluorophenyl)methyl]-3-[1-(4-methylpiperazin-1-yl)propan-2-yl]urea |
| PubChem CID | 75369977 |
| Molecular Formula | C16H24F2N4O |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 1-[(3,5-difluorophenyl)methyl]-3-[1-(4-methylpiperazin-1-yl)propan-2-yl]urea |
| SMILES | CC(CN1CCN(C)CC1)NC(=O)NCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H24F2N4O/c1-12(11-22-5-3-21(2)4-6-22)20-16(23)19-10-13-7-14(17)9-15(18)8-13/h7-9,12H,3-6,10-11H2,1-2H3,(H2,19,20,23) |
| InChIKey | LZSWJDGMCDFUHX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3,5-difluorophenyl)methyl]-3-[1-(4-methylpiperazin-1-yl)propan-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-difluorophenyl)methyl]-3-[1-(4-methylpiperazin-1-yl)propan-2-yl]urea?
The IUPAC name of 1-[(3,5-difluorophenyl)methyl]-3-[1-(4-methylpiperazin-1-yl)propan-2-yl]urea (CID 75369977) is 1-[(3,5-difluorophenyl)methyl]-3-[1-(4-methylpiperazin-1-yl)propan-2-yl]urea.
What is the SMILES notation for 1-[(3,5-difluorophenyl)methyl]-3-[1-(4-methylpiperazin-1-yl)propan-2-yl]urea?
The canonical SMILES for 1-[(3,5-difluorophenyl)methyl]-3-[1-(4-methylpiperazin-1-yl)propan-2-yl]urea is CC(CN1CCN(C)CC1)NC(=O)NCc1cc(F)cc(F)c1.
What is the InChIKey of 1-[(3,5-difluorophenyl)methyl]-3-[1-(4-methylpiperazin-1-yl)propan-2-yl]urea?
The InChIKey is LZSWJDGMCDFUHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24F2N4O/c1-12(11-22-5-3-21(2)4-6-22)20-16(23)19-10-13-7-14(17)9-15(18)8-13/h7-9,12H,3-6,10-11H2,1-2H3,(H2,19,20,23).
What are the key properties of 1-[(3,5-difluorophenyl)methyl]-3-[1-(4-methylpiperazin-1-yl)propan-2-yl]urea?
1-[(3,5-difluorophenyl)methyl]-3-[1-(4-methylpiperazin-1-yl)propan-2-yl]urea has a molecular weight of 326.39 g/mol, XLogP of 1.40, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-difluorophenyl)methyl]-3-[1-(4-methylpiperazin-1-yl)propan-2-yl]urea is sourced from PubChem (CID 75369977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).