About 2-thiophen-3-yl-4-[2-(1,2,4-triazol-1-ylmethyl)pyrrolidin-1-yl]quinazoline
2-thiophen-3-yl-4-[2-(1,2,4-triazol-1-ylmethyl)pyrrolidin-1-yl]quinazoline (PubChem CID 75370030) has the molecular formula C19H18N6S
and a molecular weight of 362.46 g/mol. Its IUPAC name is 2-thiophen-3-yl-4-[2-(1,2,4-triazol-1-ylmethyl)pyrrolidin-1-yl]quinazoline.
Molecular Properties
| Compound Name | 2-thiophen-3-yl-4-[2-(1,2,4-triazol-1-ylmethyl)pyrrolidin-1-yl]quinazoline |
| PubChem CID | 75370030 |
| Molecular Formula | C19H18N6S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-thiophen-3-yl-4-[2-(1,2,4-triazol-1-ylmethyl)pyrrolidin-1-yl]quinazoline |
| SMILES | c1ccc2c(N3CCCC3Cn3cncn3)nc(-c3ccsc3)nc2c1 |
| InChI | InChI=1S/C19H18N6S/c1-2-6-17-16(5-1)19(23-18(22-17)14-7-9-26-11-14)25-8-3-4-15(25)10-24-13-20-12-21-24/h1-2,5-7,9,11-13,15H,3-4,8,10H2 |
| InChIKey | MVSFARIMHXVCQW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-thiophen-3-yl-4-[2-(1,2,4-triazol-1-ylmethyl)pyrrolidin-1-yl]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-3-yl-4-[2-(1,2,4-triazol-1-ylmethyl)pyrrolidin-1-yl]quinazoline?
The IUPAC name of 2-thiophen-3-yl-4-[2-(1,2,4-triazol-1-ylmethyl)pyrrolidin-1-yl]quinazoline (CID 75370030) is 2-thiophen-3-yl-4-[2-(1,2,4-triazol-1-ylmethyl)pyrrolidin-1-yl]quinazoline.
What is the SMILES notation for 2-thiophen-3-yl-4-[2-(1,2,4-triazol-1-ylmethyl)pyrrolidin-1-yl]quinazoline?
The canonical SMILES for 2-thiophen-3-yl-4-[2-(1,2,4-triazol-1-ylmethyl)pyrrolidin-1-yl]quinazoline is c1ccc2c(N3CCCC3Cn3cncn3)nc(-c3ccsc3)nc2c1.
What is the InChIKey of 2-thiophen-3-yl-4-[2-(1,2,4-triazol-1-ylmethyl)pyrrolidin-1-yl]quinazoline?
The InChIKey is MVSFARIMHXVCQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N6S/c1-2-6-17-16(5-1)19(23-18(22-17)14-7-9-26-11-14)25-8-3-4-15(25)10-24-13-20-12-21-24/h1-2,5-7,9,11-13,15H,3-4,8,10H2.
What are the key properties of 2-thiophen-3-yl-4-[2-(1,2,4-triazol-1-ylmethyl)pyrrolidin-1-yl]quinazoline?
2-thiophen-3-yl-4-[2-(1,2,4-triazol-1-ylmethyl)pyrrolidin-1-yl]quinazoline has a molecular weight of 362.46 g/mol, XLogP of 3.62, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-3-yl-4-[2-(1,2,4-triazol-1-ylmethyl)pyrrolidin-1-yl]quinazoline is sourced from PubChem (CID 75370030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).